C29H24N4O8 — CID 10721533
dimethyl (1R,2R,7S)-2-benzamido-7-(3-nitrophenyl)-3-oxo-1-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-5,6-dicarboxylate (PubChem CID 10721533) has the molecular formula C29H24N4O8 and a molecular weight of 556.53 g/mol. Its IUPAC name is dimethyl (1R,2R,7S)-2-benzamido-7-(3-nitrophenyl)-3-oxo-1-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-5,6-dicarboxylate.
| Compound Name | dimethyl (1R,2R,7S)-2-benzamido-7-(3-nitrophenyl)-3-oxo-1-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-5,6-dicarboxylate |
|---|---|
| PubChem CID | 10721533 |
| Molecular Formula | C29H24N4O8 |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | dimethyl (1R,2R,7S)-2-benzamido-7-(3-nitrophenyl)-3-oxo-1-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2C(=O)[C@H](NC(=O)c3ccccc3)[C@@H](c3ccccc3)N2[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H24N4O8/c1-40-28(36)21-23(19-14-9-15-20(16-19)33(38)39)31-24(17-10-5-3-6-11-17)22(27(35)32(31)25(21)29(37)41-2)30-26(34)18-12-7-4-8-13-18/h3-16,22-24H,1-2H3,(H,30,34)/t22-,23+,24-/m1/s1 |
| InChIKey | MSHHEIBNFQARPC-TZRRMPRUSA-N |
| XLogP | 2.85 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|