C24H28N4O8 — CID 3322214
propyl 2-[[2-[(3,5-dinitrobenzoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoate (PubChem CID 3322214) has the molecular formula C24H28N4O8 and a molecular weight of 500.51 g/mol. Its IUPAC name is propyl 2-[[2-[(3,5-dinitrobenzoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoate.
| Compound Name | propyl 2-[[2-[(3,5-dinitrobenzoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 3322214 |
| Molecular Formula | C24H28N4O8 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | propyl 2-[[2-[(3,5-dinitrobenzoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoate |
| SMILES | CCCOC(=O)C(Cc1ccccc1)NC(=O)C(NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C24H28N4O8/c1-4-10-36-24(31)20(11-16-8-6-5-7-9-16)25-23(30)21(15(2)3)26-22(29)17-12-18(27(32)33)14-19(13-17)28(34)35/h5-9,12-15,20-21H,4,10-11H2,1-3H3,(H,25,30)(H,26,29) |
| InChIKey | XCZWBONMZPFZGK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|