C11H14BrNO6S — CID 107215834
5-bromo-4-(3-hydroxy-3-propan-2-ylazetidin-1-yl)sulfonylfuran-2-carboxylic acid (PubChem CID 107215834) has the molecular formula C11H14BrNO6S and a molecular weight of 368.21 g/mol. Its IUPAC name is 5-bromo-4-(3-hydroxy-3-propan-2-ylazetidin-1-yl)sulfonylfuran-2-carboxylic acid.
| Compound Name | 5-bromo-4-(3-hydroxy-3-propan-2-ylazetidin-1-yl)sulfonylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 107215834 |
| Molecular Formula | C11H14BrNO6S |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 5-bromo-4-(3-hydroxy-3-propan-2-ylazetidin-1-yl)sulfonylfuran-2-carboxylic acid |
| SMILES | CC(C)C1(O)CN(S(=O)(=O)c2cc(C(=O)O)oc2Br)C1 |
| InChI | InChI=1S/C11H14BrNO6S/c1-6(2)11(16)4-13(5-11)20(17,18)8-3-7(10(14)15)19-9(8)12/h3,6,16H,4-5H2,1-2H3,(H,14,15) |
| InChIKey | RJDURBIKGLSULU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |