C14H20N2O3 — CID 107220792
2-(4-aminophenyl)-1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-methylpropan-1-one (PubChem CID 107220792) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 2-(4-aminophenyl)-1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 107220792 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(4-aminophenyl)-1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)(C(=O)N1C[C@@H](O)[C@@H](O)C1)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-14(2,9-3-5-10(15)6-4-9)13(19)16-7-11(17)12(18)8-16/h3-6,11-12,17-18H,7-8,15H2,1-2H3/t11-,12+ |
| InChIKey | JPVNJLWNKRIDFK-TXEJJXNPSA-N |
| XLogP | 0.11 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|