C13H24N2O3 — CID 107221619
4-(aminomethyl)-N-[(1S,2S)-2-hydroxycyclohexyl]oxane-4-carboxamide (PubChem CID 107221619) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(1S,2S)-2-hydroxycyclohexyl]oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[(1S,2S)-2-hydroxycyclohexyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 107221619 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 4-(aminomethyl)-N-[(1S,2S)-2-hydroxycyclohexyl]oxane-4-carboxamide |
| SMILES | NCC1(C(=O)N[C@H]2CCCC[C@@H]2O)CCOCC1 |
| InChI | InChI=1S/C13H24N2O3/c14-9-13(5-7-18-8-6-13)12(17)15-10-3-1-2-4-11(10)16/h10-11,16H,1-9,14H2,(H,15,17)/t10-,11-/m0/s1 |
| InChIKey | XSNGBXGFPUUAOA-QWRGUYRKSA-N |
| XLogP | 0.16 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |