C15H28ClN3O3 — CID 120929053
4-(aminomethyl)-N-[2-(cyclohexylamino)-2-oxoethyl]oxane-4-carboxamide;hydrochloride (PubChem CID 120929053) has the molecular formula C15H28ClN3O3 and a molecular weight of 333.86 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[2-(cyclohexylamino)-2-oxoethyl]oxane-4-carboxamide;hydrochloride.
| Compound Name | 4-(aminomethyl)-N-[2-(cyclohexylamino)-2-oxoethyl]oxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120929053 |
| Molecular Formula | C15H28ClN3O3 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 4-(aminomethyl)-N-[2-(cyclohexylamino)-2-oxoethyl]oxane-4-carboxamide;hydrochloride |
| SMILES | Cl.NCC1(C(=O)NCC(=O)NC2CCCCC2)CCOCC1 |
| InChI | InChI=1S/C15H27N3O3.ClH/c16-11-15(6-8-21-9-7-15)14(20)17-10-13(19)18-12-4-2-1-3-5-12;/h12H,1-11,16H2,(H,17,20)(H,18,19);1H |
| InChIKey | RQGFGCGDCYHPHM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |