C16H31Cl2N3O2 — CID 120941198
4-(aminomethyl)-N-(1-cyclopentylpyrrolidin-3-yl)oxane-4-carboxamide;dihydrochloride (PubChem CID 120941198) has the molecular formula C16H31Cl2N3O2 and a molecular weight of 368.35 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(1-cyclopentylpyrrolidin-3-yl)oxane-4-carboxamide;dihydrochloride.
| Compound Name | 4-(aminomethyl)-N-(1-cyclopentylpyrrolidin-3-yl)oxane-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120941198 |
| Molecular Formula | C16H31Cl2N3O2 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 4-(aminomethyl)-N-(1-cyclopentylpyrrolidin-3-yl)oxane-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCC1(C(=O)NC2CCN(C3CCCC3)C2)CCOCC1 |
| InChI | InChI=1S/C16H29N3O2.2ClH/c17-12-16(6-9-21-10-7-16)15(20)18-13-5-8-19(11-13)14-3-1-2-4-14;;/h13-14H,1-12,17H2,(H,18,20);2*1H |
| InChIKey | SOSCZOHMWBKMRJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |