About N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide
N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide (PubChem CID 107222046) has the molecular formula C14H27N3O2
and a molecular weight of 269.39 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide |
| PubChem CID | 107222046 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide |
| SMILES | CC(C)(C(=O)N[C@@H]1CCCC[C@H]1O)N1CCNCC1 |
| InChI | InChI=1S/C14H27N3O2/c1-14(2,17-9-7-15-8-10-17)13(19)16-11-5-3-4-6-12(11)18/h11-12,15,18H,3-10H2,1-2H3,(H,16,19)/t11-,12-/m1/s1 |
| InChIKey | PJEBRSCTZASURK-VXGBXAGGSA-N |
| XLogP | 0.09 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide?
The IUPAC name of N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide (CID 107222046) is N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide.
What is the SMILES notation for N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide?
The canonical SMILES for N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide is CC(C)(C(=O)N[C@@H]1CCCC[C@H]1O)N1CCNCC1.
What is the InChIKey of N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide?
The InChIKey is PJEBRSCTZASURK-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H27N3O2/c1-14(2,17-9-7-15-8-10-17)13(19)16-11-5-3-4-6-12(11)18/h11-12,15,18H,3-10H2,1-2H3,(H,16,19)/t11-,12-/m1/s1.
What are the key properties of N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide?
N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide has a molecular weight of 269.39 g/mol, XLogP of 0.09, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-hydroxycyclohexyl]-2-methyl-2-piperazin-1-ylpropanamide is sourced from PubChem (CID 107222046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).