C12H24N2O2 — CID 107222009
2-amino-N-[(1R,2R)-2-hydroxycyclohexyl]-2-methylpentanamide (PubChem CID 107222009) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-amino-N-[(1R,2R)-2-hydroxycyclohexyl]-2-methylpentanamide.
| Compound Name | 2-amino-N-[(1R,2R)-2-hydroxycyclohexyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 107222009 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-amino-N-[(1R,2R)-2-hydroxycyclohexyl]-2-methylpentanamide |
| SMILES | CCCC(C)(N)C(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C12H24N2O2/c1-3-8-12(2,13)11(16)14-9-6-4-5-7-10(9)15/h9-10,15H,3-8,13H2,1-2H3,(H,14,16)/t9-,10-,12?/m1/s1 |
| InChIKey | GGMBWDRBPKSMOF-UVTZGIPTSA-N |
| XLogP | 0.92 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |