C11H20ClNO2 — CID 107216789
3-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-2,2-dimethylpropanamide (PubChem CID 107216789) has the molecular formula C11H20ClNO2 and a molecular weight of 233.74 g/mol. Its IUPAC name is 3-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 107216789 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C11H20ClNO2/c1-11(2,7-12)10(15)13-8-5-3-4-6-9(8)14/h8-9,14H,3-7H2,1-2H3,(H,13,15)/t8-,9-/m1/s1 |
| InChIKey | SHWHHJRVLYANPV-RKDXNWHRSA-N |
| XLogP | 1.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|