C8H12ClF2NO2 — CID 40538955
2-chloro-2,2-difluoro-N-[(1R,2S)-2-hydroxycyclohexyl]acetamide (PubChem CID 40538955) has the molecular formula C8H12ClF2NO2 and a molecular weight of 227.64 g/mol. Its IUPAC name is 2-chloro-2,2-difluoro-N-[(1R,2S)-2-hydroxycyclohexyl]acetamide.
| Compound Name | 2-chloro-2,2-difluoro-N-[(1R,2S)-2-hydroxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 40538955 |
| Molecular Formula | C8H12ClF2NO2 |
| Molecular Weight | 227.64 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-chloro-2,2-difluoro-N-[(1R,2S)-2-hydroxycyclohexyl]acetamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H]1O)C(F)(F)Cl |
| InChI | InChI=1S/C8H12ClF2NO2/c9-8(10,11)7(14)12-5-3-1-2-4-6(5)13/h5-6,13H,1-4H2,(H,12,14)/t5-,6+/m1/s1 |
| InChIKey | WRSQOBOPYSIVEC-RITPCOANSA-N |
| XLogP | 1.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.64 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|