C10H15ClF2N2O2 — CID 99697543
trans-(1R,2R)-2-[(2-chloro-2,2-difluoroacetyl)amino]-N-methylcyclohexane-1-carboxamide (PubChem CID 99697543) has the molecular formula C10H15ClF2N2O2 and a molecular weight of 268.69 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(2-chloro-2,2-difluoroacetyl)amino]-N-methylcyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-[(2-chloro-2,2-difluoroacetyl)amino]-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 99697543 |
| Molecular Formula | C10H15ClF2N2O2 |
| Molecular Weight | 268.69 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | trans-(1R,2R)-2-[(2-chloro-2,2-difluoroacetyl)amino]-N-methylcyclohexane-1-carboxamide |
| SMILES | CNC(=O)[C@@H]1CCCC[C@H]1NC(=O)C(F)(F)Cl |
| InChI | InChI=1S/C10H15ClF2N2O2/c1-14-8(16)6-4-2-3-5-7(6)15-9(17)10(11,12)13/h6-7H,2-5H2,1H3,(H,14,16)(H,15,17)/t6-,7-/m1/s1 |
| InChIKey | KCIBVJGCDHQMBU-RNFRBKRXSA-N |
| XLogP | 1.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.69 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|