C15H17F3N2O2 — CID 99589594
2,3,6-trifluoro-N-[(1R,2S)-2-(methylcarbamoyl)cyclohexyl]benzamide (PubChem CID 99589594) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is 2,3,6-trifluoro-N-[(1R,2S)-2-(methylcarbamoyl)cyclohexyl]benzamide.
| Compound Name | 2,3,6-trifluoro-N-[(1R,2S)-2-(methylcarbamoyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 99589594 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2,3,6-trifluoro-N-[(1R,2S)-2-(methylcarbamoyl)cyclohexyl]benzamide |
| SMILES | CNC(=O)[C@H]1CCCC[C@H]1NC(=O)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C15H17F3N2O2/c1-19-14(21)8-4-2-3-5-11(8)20-15(22)12-9(16)6-7-10(17)13(12)18/h6-8,11H,2-5H2,1H3,(H,19,21)(H,20,22)/t8-,11+/m0/s1 |
| InChIKey | YWARDQHVRUNOFO-GZMMTYOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|