C16H21N3O4 — CID 75395789
methyl N-[3-[[2-(methylcarbamoyl)cyclopentyl]carbamoyl]phenyl]carbamate (PubChem CID 75395789) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl N-[3-[[2-(methylcarbamoyl)cyclopentyl]carbamoyl]phenyl]carbamate.
| Compound Name | methyl N-[3-[[2-(methylcarbamoyl)cyclopentyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 75395789 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | methyl N-[3-[[2-(methylcarbamoyl)cyclopentyl]carbamoyl]phenyl]carbamate |
| SMILES | CNC(=O)C1CCCC1NC(=O)c1cccc(NC(=O)OC)c1 |
| InChI | InChI=1S/C16H21N3O4/c1-17-15(21)12-7-4-8-13(12)19-14(20)10-5-3-6-11(9-10)18-16(22)23-2/h3,5-6,9,12-13H,4,7-8H2,1-2H3,(H,17,21)(H,18,22)(H,19,20) |
| InChIKey | WMMMZEOJMBJTPJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |