C9H15F3N2O2 — CID 104954569
1-[(1S,2S)-2-hydroxycyclohexyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 104954569) has the molecular formula C9H15F3N2O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 1-[(1S,2S)-2-hydroxycyclohexyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[(1S,2S)-2-hydroxycyclohexyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 104954569 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-[(1S,2S)-2-hydroxycyclohexyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C9H15F3N2O2/c10-9(11,12)5-13-8(16)14-6-3-1-2-4-7(6)15/h6-7,15H,1-5H2,(H2,13,14,16)/t6-,7-/m0/s1 |
| InChIKey | QSJINCSBHNIHRV-BQBZGAKWSA-N |
| XLogP | 1.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |