C15H27N3O2 — CID 107222957
[(3S)-3-hydroxypiperidin-1-yl]-(1-piperidin-4-ylpyrrolidin-2-yl)methanone (PubChem CID 107222957) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is [(3S)-3-hydroxypiperidin-1-yl]-(1-piperidin-4-ylpyrrolidin-2-yl)methanone.
| Compound Name | [(3S)-3-hydroxypiperidin-1-yl]-(1-piperidin-4-ylpyrrolidin-2-yl)methanone |
|---|---|
| PubChem CID | 107222957 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | [(3S)-3-hydroxypiperidin-1-yl]-(1-piperidin-4-ylpyrrolidin-2-yl)methanone |
| SMILES | O=C(C1CCCN1C1CCNCC1)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C15H27N3O2/c19-13-3-1-9-17(11-13)15(20)14-4-2-10-18(14)12-5-7-16-8-6-12/h12-14,16,19H,1-11H2/t13-,14?/m0/s1 |
| InChIKey | GMYBMVXTRMWCOL-LSLKUGRBSA-N |
| XLogP | 0.19 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |