C15H25N3O3 — CID 64604814
2-[1-(1-piperidin-4-ylpyrrolidine-2-carbonyl)azetidin-3-yl]acetic acid (PubChem CID 64604814) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-[1-(1-piperidin-4-ylpyrrolidine-2-carbonyl)azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-(1-piperidin-4-ylpyrrolidine-2-carbonyl)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 64604814 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-[1-(1-piperidin-4-ylpyrrolidine-2-carbonyl)azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)C2CCCN2C2CCNCC2)C1 |
| InChI | InChI=1S/C15H25N3O3/c19-14(20)8-11-9-17(10-11)15(21)13-2-1-7-18(13)12-3-5-16-6-4-12/h11-13,16H,1-10H2,(H,19,20) |
| InChIKey | FFLDFSKZUJXXOJ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |