C31H29AgO4S — CID 10722368
silver 2-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl]-3,6-bis(phenylmethoxy)benzenethiolate (PubChem CID 10722368) has the molecular formula C31H29AgO4S and a molecular weight of 605.50 g/mol. Its IUPAC name is silver 2-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl]-3,6-bis(phenylmethoxy)benzenethiolate.
| Compound Name | silver 2-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl]-3,6-bis(phenylmethoxy)benzenethiolate |
|---|---|
| PubChem CID | 10722368 |
| Molecular Formula | C31H29AgO4S |
| Molecular Weight | 605.50 g/mol |
| Exact Mass | 604.08 |
| IUPAC Name | silver 2-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl]-3,6-bis(phenylmethoxy)benzenethiolate |
| SMILES | COc1ccc(/C=C/Cc2c(OCc3ccccc3)ccc(OCc3ccccc3)c2[S-])cc1OC.[Ag+] |
| InChI | InChI=1S/C31H30O4S.Ag/c1-32-28-17-16-23(20-30(28)33-2)14-9-15-26-27(34-21-24-10-5-3-6-11-24)18-19-29(31(26)36)35-22-25-12-7-4-8-13-25;/h3-14,16-20,36H,15,21-22H2,1-2H3;/q;+1/p-1/b14-9+; |
| InChIKey | HAYPNFNJVSHWMO-KYIGKLDSSA-M |
| XLogP | 7.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.50 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|