C34H31N5O6 — CID 10722372
4-[[2-[2,4-dioxo-5-phenyl-3-(phenylcarbamoylamino)-1,5-benzodiazepin-1-yl]acetyl]-propan-2-ylamino]benzoic acid (PubChem CID 10722372) has the molecular formula C34H31N5O6 and a molecular weight of 605.65 g/mol. Its IUPAC name is 4-[[2-[2,4-dioxo-5-phenyl-3-(phenylcarbamoylamino)-1,5-benzodiazepin-1-yl]acetyl]-propan-2-ylamino]benzoic acid.
| Compound Name | 4-[[2-[2,4-dioxo-5-phenyl-3-(phenylcarbamoylamino)-1,5-benzodiazepin-1-yl]acetyl]-propan-2-ylamino]benzoic acid |
|---|---|
| PubChem CID | 10722372 |
| Molecular Formula | C34H31N5O6 |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | 4-[[2-[2,4-dioxo-5-phenyl-3-(phenylcarbamoylamino)-1,5-benzodiazepin-1-yl]acetyl]-propan-2-ylamino]benzoic acid |
| SMILES | CC(C)N(C(=O)CN1C(=O)C(NC(=O)Nc2ccccc2)C(=O)N(c2ccccc2)c2ccccc21)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C34H31N5O6/c1-22(2)38(26-19-17-23(18-20-26)33(43)44)29(40)21-37-27-15-9-10-16-28(27)39(25-13-7-4-8-14-25)32(42)30(31(37)41)36-34(45)35-24-11-5-3-6-12-24/h3-20,22,30H,21H2,1-2H3,(H,43,44)(H2,35,36,45) |
| InChIKey | RZRJFCIXLUAQCE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|