C13H22ClN3OS — CID 107224024
2-[4-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1,4-diazepan-1-yl]ethanol (PubChem CID 107224024) has the molecular formula C13H22ClN3OS and a molecular weight of 303.86 g/mol. Its IUPAC name is 2-[4-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 107224024 |
| Molecular Formula | C13H22ClN3OS |
| Molecular Weight | 303.86 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-[4-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1,4-diazepan-1-yl]ethanol |
| SMILES | CC(c1nc(CCl)cs1)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C13H22ClN3OS/c1-11(13-15-12(9-14)10-19-13)17-4-2-3-16(5-6-17)7-8-18/h10-11,18H,2-9H2,1H3 |
| InChIKey | PVJXMLBKVMXQGI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.86 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|