C33H50N2O5S2 — CID 10722532
tert-butyl (4R)-4-[(1E,3S,4E,6R)-6-benzyl-7-[[(2S)-1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl]amino]-7-oxo-3-propan-2-ylhepta-1,4-dienyl]-2,2-dimethyl-1,3-thiazolidine-3-carboxylate (PubChem CID 10722532) has the molecular formula C33H50N2O5S2 and a molecular weight of 618.91 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1E,3S,4E,6R)-6-benzyl-7-[[(2S)-1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl]amino]-7-oxo-3-propan-2-ylhepta-1,4-dienyl]-2,2-dimethyl-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1E,3S,4E,6R)-6-benzyl-7-[[(2S)-1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl]amino]-7-oxo-3-propan-2-ylhepta-1,4-dienyl]-2,2-dimethyl-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10722532 |
| Molecular Formula | C33H50N2O5S2 |
| Molecular Weight | 618.91 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | tert-butyl (4R)-4-[(1E,3S,4E,6R)-6-benzyl-7-[[(2S)-1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl]amino]-7-oxo-3-propan-2-ylhepta-1,4-dienyl]-2,2-dimethyl-1,3-thiazolidine-3-carboxylate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)[C@@H](/C=C/[C@@H](/C=C/[C@@H]1CSC(C)(C)N1C(=O)OC(C)(C)C)C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C33H50N2O5S2/c1-23(2)25(17-18-27-22-42-33(6,7)35(27)31(38)40-32(3,4)5)15-16-26(21-24-13-11-10-12-14-24)29(36)34-28(19-20-41-9)30(37)39-8/h10-18,23,25-28H,19-22H2,1-9H3,(H,34,36)/b16-15+,18-17+/t25-,26-,27+,28-/m0/s1 |
| InChIKey | FWIIYGLDNIMQPP-RCEYIXASSA-N |
| XLogP | 6.73 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.91 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|