C9H19N5O — CID 107225557
2-[4-(2-azidoethyl)-1,4-diazepan-1-yl]ethanol (PubChem CID 107225557) has the molecular formula C9H19N5O and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[4-(2-azidoethyl)-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-(2-azidoethyl)-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 107225557 |
| Molecular Formula | C9H19N5O |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 2-[4-(2-azidoethyl)-1,4-diazepan-1-yl]ethanol |
| SMILES | [N-]=[N+]=NCCN1CCCN(CCO)CC1 |
| InChI | InChI=1S/C9H19N5O/c10-12-11-2-5-13-3-1-4-14(7-6-13)8-9-15/h15H,1-9H2 |
| InChIKey | LQDPPYQSAXFMKE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|