C10H17N3O2 — CID 107225702
(3S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]piperidin-3-ol (PubChem CID 107225702) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is (3S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]piperidin-3-ol.
| Compound Name | (3S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 107225702 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | (3S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]piperidin-3-ol |
| SMILES | CCc1nc(CN2CCC[C@H](O)C2)no1 |
| InChI | InChI=1S/C10H17N3O2/c1-2-10-11-9(12-15-10)7-13-5-3-4-8(14)6-13/h8,14H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | SUWYZOVDEZLSIW-QMMMGPOBSA-N |
| XLogP | 0.59 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |