C14H23N3O2 — CID 114286653
2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 114286653) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 114286653 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CCc1nc(CN2CCC3(O)CCCCC3C2)no1 |
| InChI | InChI=1S/C14H23N3O2/c1-2-13-15-12(16-19-13)10-17-8-7-14(18)6-4-3-5-11(14)9-17/h11,18H,2-10H2,1H3 |
| InChIKey | RUGSNPMAFMNIKE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |