C14H21FN2O3S — CID 107227335
2-[1-[3-(aminomethyl)-4-fluorophenyl]sulfonylpiperidin-3-yl]ethanol (PubChem CID 107227335) has the molecular formula C14H21FN2O3S and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[1-[3-(aminomethyl)-4-fluorophenyl]sulfonylpiperidin-3-yl]ethanol.
| Compound Name | 2-[1-[3-(aminomethyl)-4-fluorophenyl]sulfonylpiperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 107227335 |
| Molecular Formula | C14H21FN2O3S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-[1-[3-(aminomethyl)-4-fluorophenyl]sulfonylpiperidin-3-yl]ethanol |
| SMILES | NCc1cc(S(=O)(=O)N2CCCC(CCO)C2)ccc1F |
| InChI | InChI=1S/C14H21FN2O3S/c15-14-4-3-13(8-12(14)9-16)21(19,20)17-6-1-2-11(10-17)5-7-18/h3-4,8,11,18H,1-2,5-7,9-10,16H2 |
| InChIKey | OMFQZIFHFOZPPQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |