C11H15FN2O3S — CID 63288683
1-[3-(aminomethyl)-4-fluorophenyl]sulfonylpyrrolidin-3-ol (PubChem CID 63288683) has the molecular formula C11H15FN2O3S and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-4-fluorophenyl]sulfonylpyrrolidin-3-ol.
| Compound Name | 1-[3-(aminomethyl)-4-fluorophenyl]sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 63288683 |
| Molecular Formula | C11H15FN2O3S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-[3-(aminomethyl)-4-fluorophenyl]sulfonylpyrrolidin-3-ol |
| SMILES | NCc1cc(S(=O)(=O)N2CCC(O)C2)ccc1F |
| InChI | InChI=1S/C11H15FN2O3S/c12-11-2-1-10(5-8(11)6-13)18(16,17)14-4-3-9(15)7-14/h1-2,5,9,15H,3-4,6-7,13H2 |
| InChIKey | GWNUAKCVXVJNLX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |