C46H38N2O2 — CID 10722916
(6E)-4-ethoxy-6-(4-ethoxy-2,2-diphenylquinolin-6-ylidene)-2,2-diphenylquinoline (PubChem CID 10722916) has the molecular formula C46H38N2O2 and a molecular weight of 650.82 g/mol. Its IUPAC name is (6E)-4-ethoxy-6-(4-ethoxy-2,2-diphenylquinolin-6-ylidene)-2,2-diphenylquinoline.
| Compound Name | (6E)-4-ethoxy-6-(4-ethoxy-2,2-diphenylquinolin-6-ylidene)-2,2-diphenylquinoline |
|---|---|
| PubChem CID | 10722916 |
| Molecular Formula | C46H38N2O2 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | (6E)-4-ethoxy-6-(4-ethoxy-2,2-diphenylquinolin-6-ylidene)-2,2-diphenylquinoline |
| SMILES | CCOC1=CC(c2ccccc2)(c2ccccc2)N=c2cc/c(=c3/ccc4c(c3)C(OCC)=CC(c3ccccc3)(c3ccccc3)N=4)cc21 |
| InChI | InChI=1S/C46H38N2O2/c1-3-49-43-31-45(35-17-9-5-10-18-35,36-19-11-6-12-20-36)47-41-27-25-33(29-39(41)43)34-26-28-42-40(30-34)44(50-4-2)32-46(48-42,37-21-13-7-14-22-37)38-23-15-8-16-24-38/h5-32H,3-4H2,1-2H3/b34-33+ |
| InChIKey | VAUKELOCDWCPLX-JEIPZWNWSA-N |
| XLogP | 8.88 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |