C21H21NO6 — CID 1072314
(5R)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)-1-methylpyrrolidine-2,3-dione (PubChem CID 1072314) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is (5R)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)-1-methylpyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)-1-methylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 1072314 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (5R)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)-1-methylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(C)[C@@H]2c2ccccc2OC)cc1OC |
| InChI | InChI=1S/C21H21NO6/c1-22-18(13-7-5-6-8-14(13)26-2)17(20(24)21(22)25)19(23)12-9-10-15(27-3)16(11-12)28-4/h5-11,18,23H,1-4H3/t18-/m1/s1 |
| InChIKey | IQMCXZKKHFGQQB-GOSISDBHSA-N |
| XLogP | 2.76 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|