C16H11F17N2O4S2 — CID 10723227
4-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)ethyl]benzenesulfonamide (PubChem CID 10723227) has the molecular formula C16H11F17N2O4S2 and a molecular weight of 682.37 g/mol. Its IUPAC name is 4-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10723227 |
| Molecular Formula | C16H11F17N2O4S2 |
| Molecular Weight | 682.37 g/mol |
| Exact Mass | 681.99 |
| IUPAC Name | 4-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F17N2O4S2/c17-9(18,11(21,22)13(25,26)15(29,30)31)10(19,20)12(23,24)14(27,28)16(32,33)41(38,39)35-6-5-7-1-3-8(4-2-7)40(34,36)37/h1-4,35H,5-6H2,(H2,34,36,37) |
| InChIKey | HYUFJNMGKWPGDH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|