C19H20N2 — CID 107234743
N-[(1-methylindol-3-yl)methyl]-2,3-dihydro-1H-inden-1-amine (PubChem CID 107234743) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[(1-methylindol-3-yl)methyl]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-[(1-methylindol-3-yl)methyl]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 107234743 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-[(1-methylindol-3-yl)methyl]-2,3-dihydro-1H-inden-1-amine |
| SMILES | Cn1cc(CNC2CCc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C19H20N2/c1-21-13-15(17-8-4-5-9-19(17)21)12-20-18-11-10-14-6-2-3-7-16(14)18/h2-9,13,18,20H,10-12H2,1H3 |
| InChIKey | QMTFZCHMJDPLMO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |