C15H21N3 — CID 115117392
1-N-[(1-methylindol-3-yl)methyl]cyclopentane-1,2-diamine (PubChem CID 115117392) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-N-[(1-methylindol-3-yl)methyl]cyclopentane-1,2-diamine.
| Compound Name | 1-N-[(1-methylindol-3-yl)methyl]cyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 115117392 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 1-N-[(1-methylindol-3-yl)methyl]cyclopentane-1,2-diamine |
| SMILES | Cn1cc(CNC2CCCC2N)c2ccccc21 |
| InChI | InChI=1S/C15H21N3/c1-18-10-11(12-5-2-3-8-15(12)18)9-17-14-7-4-6-13(14)16/h2-3,5,8,10,13-14,17H,4,6-7,9,16H2,1H3 |
| InChIKey | XQEPTQQMWDTXOF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |