C16H20N4 — CID 107236269
3-(1H-imidazol-2-yl)-N-[(1-methylindol-3-yl)methyl]propan-1-amine (PubChem CID 107236269) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-(1H-imidazol-2-yl)-N-[(1-methylindol-3-yl)methyl]propan-1-amine.
| Compound Name | 3-(1H-imidazol-2-yl)-N-[(1-methylindol-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107236269 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 3-(1H-imidazol-2-yl)-N-[(1-methylindol-3-yl)methyl]propan-1-amine |
| SMILES | Cn1cc(CNCCCc2ncc[nH]2)c2ccccc21 |
| InChI | InChI=1S/C16H20N4/c1-20-12-13(14-5-2-3-6-15(14)20)11-17-8-4-7-16-18-9-10-19-16/h2-3,5-6,9-10,12,17H,4,7-8,11H2,1H3,(H,18,19) |
| InChIKey | QGBPVKCCHBEHSE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|