C13H22N4O2 — CID 107237572
tert-butyl N-[2-[1-(1H-pyrazol-5-yl)ethylamino]cyclopropyl]carbamate (PubChem CID 107237572) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(1H-pyrazol-5-yl)ethylamino]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(1H-pyrazol-5-yl)ethylamino]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 107237572 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | tert-butyl N-[2-[1-(1H-pyrazol-5-yl)ethylamino]cyclopropyl]carbamate |
| SMILES | CC(NC1CC1NC(=O)OC(C)(C)C)c1ccn[nH]1 |
| InChI | InChI=1S/C13H22N4O2/c1-8(9-5-6-14-17-9)15-10-7-11(10)16-12(18)19-13(2,3)4/h5-6,8,10-11,15H,7H2,1-4H3,(H,14,17)(H,16,18) |
| InChIKey | LTNWZZNAVWVHGY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |