C16H24N2O4 — CID 107237842
tert-butyl N-[2-[1-(2,4-dihydroxyphenyl)ethylamino]cyclopropyl]carbamate (PubChem CID 107237842) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(2,4-dihydroxyphenyl)ethylamino]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(2,4-dihydroxyphenyl)ethylamino]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 107237842 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | tert-butyl N-[2-[1-(2,4-dihydroxyphenyl)ethylamino]cyclopropyl]carbamate |
| SMILES | CC(NC1CC1NC(=O)OC(C)(C)C)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H24N2O4/c1-9(11-6-5-10(19)7-14(11)20)17-12-8-13(12)18-15(21)22-16(2,3)4/h5-7,9,12-13,17,19-20H,8H2,1-4H3,(H,18,21) |
| InChIKey | HPVOHXITOBHAAZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|