C16H20FN3O2S — CID 107241046
tert-butyl N-[3-[(3-aminothiophen-2-yl)methylamino]-4-fluorophenyl]carbamate (PubChem CID 107241046) has the molecular formula C16H20FN3O2S and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl N-[3-[(3-aminothiophen-2-yl)methylamino]-4-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3-aminothiophen-2-yl)methylamino]-4-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 107241046 |
| Molecular Formula | C16H20FN3O2S |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | tert-butyl N-[3-[(3-aminothiophen-2-yl)methylamino]-4-fluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(F)c(NCc2sccc2N)c1 |
| InChI | InChI=1S/C16H20FN3O2S/c1-16(2,3)22-15(21)20-10-4-5-11(17)13(8-10)19-9-14-12(18)6-7-23-14/h4-8,19H,9,18H2,1-3H3,(H,20,21) |
| InChIKey | MQCVPQLJOCNQSK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |