C12H14FN3O2S2 — CID 66387952
N-[5-[(3-aminothiophen-2-yl)methylamino]-2-fluorophenyl]methanesulfonamide (PubChem CID 66387952) has the molecular formula C12H14FN3O2S2 and a molecular weight of 315.40 g/mol. Its IUPAC name is N-[5-[(3-aminothiophen-2-yl)methylamino]-2-fluorophenyl]methanesulfonamide.
| Compound Name | N-[5-[(3-aminothiophen-2-yl)methylamino]-2-fluorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 66387952 |
| Molecular Formula | C12H14FN3O2S2 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-[5-[(3-aminothiophen-2-yl)methylamino]-2-fluorophenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(NCc2sccc2N)ccc1F |
| InChI | InChI=1S/C12H14FN3O2S2/c1-20(17,18)16-11-6-8(2-3-9(11)13)15-7-12-10(14)4-5-19-12/h2-6,15-16H,7,14H2,1H3 |
| InChIKey | BWMSGXTXFJDMND-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |