C54H56O10 — CID 10724297
(4R,5S,6R)-4-phenylmethoxy-6-(phenylmethoxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-one (PubChem CID 10724297) has the molecular formula C54H56O10 and a molecular weight of 865.03 g/mol. Its IUPAC name is (4R,5S,6R)-4-phenylmethoxy-6-(phenylmethoxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-one.
| Compound Name | (4R,5S,6R)-4-phenylmethoxy-6-(phenylmethoxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-one |
|---|---|
| PubChem CID | 10724297 |
| Molecular Formula | C54H56O10 |
| Molecular Weight | 865.03 g/mol |
| Exact Mass | 864.39 |
| IUPAC Name | (4R,5S,6R)-4-phenylmethoxy-6-(phenylmethoxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-one |
| SMILES | O=C1C[C@@H](OCc2ccccc2)[C@H](O[C@@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C54H56O10/c55-49-31-46(58-34-42-23-11-3-12-24-42)50(47(62-49)38-56-32-40-19-7-1-8-20-40)64-54-53(61-37-45-29-17-6-18-30-45)52(60-36-44-27-15-5-16-28-44)51(59-35-43-25-13-4-14-26-43)48(63-54)39-57-33-41-21-9-2-10-22-41/h1-30,46-48,50-54H,31-39H2/t46-,47-,48-,50+,51+,52+,53-,54+/m1/s1 |
| InChIKey | AKGNTMUOZSAAFM-CRWJRRQZSA-N |
| XLogP | 9.19 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.03 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |