C17H26N2O4 — CID 107243030
methyl 2-[3-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]anilino]propanoate (PubChem CID 107243030) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is methyl 2-[3-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]anilino]propanoate.
| Compound Name | methyl 2-[3-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]anilino]propanoate |
|---|---|
| PubChem CID | 107243030 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | methyl 2-[3-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]anilino]propanoate |
| SMILES | COC(=O)C(C)Nc1cccc(CN(C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H26N2O4/c1-12(15(20)22-6)18-14-9-7-8-13(10-14)11-19(5)16(21)23-17(2,3)4/h7-10,12,18H,11H2,1-6H3 |
| InChIKey | BMNCBACCLKMDLE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |