C17H28N4O2 — CID 107243166
tert-butyl N-[5-[(1-methylpiperidin-3-yl)methylamino]-2-pyridinyl]carbamate (PubChem CID 107243166) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is tert-butyl N-[5-[(1-methylpiperidin-3-yl)methylamino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[(1-methylpiperidin-3-yl)methylamino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 107243166 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | tert-butyl N-[5-[(1-methylpiperidin-3-yl)methylamino]-2-pyridinyl]carbamate |
| SMILES | CN1CCCC(CNc2ccc(NC(=O)OC(C)(C)C)nc2)C1 |
| InChI | InChI=1S/C17H28N4O2/c1-17(2,3)23-16(22)20-15-8-7-14(11-19-15)18-10-13-6-5-9-21(4)12-13/h7-8,11,13,18H,5-6,9-10,12H2,1-4H3,(H,19,20,22) |
| InChIKey | ZGHMWOFXHBLDFP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |