C18H34N2O2 — CID 107244035
tert-butyl N-[1-cyclopropyl-2-[(2-ethylcyclohexyl)amino]ethyl]carbamate (PubChem CID 107244035) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is tert-butyl N-[1-cyclopropyl-2-[(2-ethylcyclohexyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-cyclopropyl-2-[(2-ethylcyclohexyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 107244035 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | tert-butyl N-[1-cyclopropyl-2-[(2-ethylcyclohexyl)amino]ethyl]carbamate |
| SMILES | CCC1CCCCC1NCC(NC(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C18H34N2O2/c1-5-13-8-6-7-9-15(13)19-12-16(14-10-11-14)20-17(21)22-18(2,3)4/h13-16,19H,5-12H2,1-4H3,(H,20,21) |
| InChIKey | SAYJZWQAHMDZKZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |