C15H28N2O2S — CID 103872279
tert-butyl N-[1-cyclopropyl-2-(thian-4-ylamino)ethyl]carbamate (PubChem CID 103872279) has the molecular formula C15H28N2O2S and a molecular weight of 300.47 g/mol. Its IUPAC name is tert-butyl N-[1-cyclopropyl-2-(thian-4-ylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-cyclopropyl-2-(thian-4-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 103872279 |
| Molecular Formula | C15H28N2O2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | tert-butyl N-[1-cyclopropyl-2-(thian-4-ylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CNC1CCSCC1)C1CC1 |
| InChI | InChI=1S/C15H28N2O2S/c1-15(2,3)19-14(18)17-13(11-4-5-11)10-16-12-6-8-20-9-7-12/h11-13,16H,4-10H2,1-3H3,(H,17,18) |
| InChIKey | QHBNIUOWZHSRCS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |