C17H34N2O2 — CID 107244394
tert-butyl 2-[2-(2-methylpentylamino)ethyl]pyrrolidine-1-carboxylate (PubChem CID 107244394) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is tert-butyl 2-[2-(2-methylpentylamino)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(2-methylpentylamino)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107244394 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | tert-butyl 2-[2-(2-methylpentylamino)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CCCC(C)CNCCC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H34N2O2/c1-6-8-14(2)13-18-11-10-15-9-7-12-19(15)16(20)21-17(3,4)5/h14-15,18H,6-13H2,1-5H3 |
| InChIKey | PPRSGTRWJGPBFM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|