C16H32N2O4S — CID 107244540
tert-butyl 2-[2-(1-ethylsulfonylpropan-2-ylamino)ethyl]pyrrolidine-1-carboxylate (PubChem CID 107244540) has the molecular formula C16H32N2O4S and a molecular weight of 348.51 g/mol. Its IUPAC name is tert-butyl 2-[2-(1-ethylsulfonylpropan-2-ylamino)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(1-ethylsulfonylpropan-2-ylamino)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107244540 |
| Molecular Formula | C16H32N2O4S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | tert-butyl 2-[2-(1-ethylsulfonylpropan-2-ylamino)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CCS(=O)(=O)CC(C)NCCC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H32N2O4S/c1-6-23(20,21)12-13(2)17-10-9-14-8-7-11-18(14)15(19)22-16(3,4)5/h13-14,17H,6-12H2,1-5H3 |
| InChIKey | QMHUORKNVCOAAA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |