C18H36N2O3 — CID 107245582
tert-butyl N-[2-[[1-(hydroxymethyl)cyclohexyl]methylamino]ethyl]-N-propan-2-ylcarbamate (PubChem CID 107245582) has the molecular formula C18H36N2O3 and a molecular weight of 328.50 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(hydroxymethyl)cyclohexyl]methylamino]ethyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[2-[[1-(hydroxymethyl)cyclohexyl]methylamino]ethyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 107245582 |
| Molecular Formula | C18H36N2O3 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.27 |
| IUPAC Name | tert-butyl N-[2-[[1-(hydroxymethyl)cyclohexyl]methylamino]ethyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CCNCC1(CO)CCCCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H36N2O3/c1-15(2)20(16(22)23-17(3,4)5)12-11-19-13-18(14-21)9-7-6-8-10-18/h15,19,21H,6-14H2,1-5H3 |
| InChIKey | ZPLRPQRTABBNQM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|