C17H36N2O3 — CID 107245945
tert-butyl N-[2-[[2-ethyl-2-(hydroxymethyl)butyl]amino]ethyl]-N-propan-2-ylcarbamate (PubChem CID 107245945) has the molecular formula C17H36N2O3 and a molecular weight of 316.49 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-ethyl-2-(hydroxymethyl)butyl]amino]ethyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[2-[[2-ethyl-2-(hydroxymethyl)butyl]amino]ethyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 107245945 |
| Molecular Formula | C17H36N2O3 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.27 |
| IUPAC Name | tert-butyl N-[2-[[2-ethyl-2-(hydroxymethyl)butyl]amino]ethyl]-N-propan-2-ylcarbamate |
| SMILES | CCC(CC)(CO)CNCCN(C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H36N2O3/c1-8-17(9-2,13-20)12-18-10-11-19(14(3)4)15(21)22-16(5,6)7/h14,18,20H,8-13H2,1-7H3 |
| InChIKey | XZYAIQNCZJLXPW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|