C15H32N2O3 — CID 107246113
tert-butyl N-[2-[(3-hydroxy-2,2-dimethylpropyl)amino]ethyl]-N-propylcarbamate (PubChem CID 107246113) has the molecular formula C15H32N2O3 and a molecular weight of 288.43 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-hydroxy-2,2-dimethylpropyl)amino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[(3-hydroxy-2,2-dimethylpropyl)amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 107246113 |
| Molecular Formula | C15H32N2O3 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | tert-butyl N-[2-[(3-hydroxy-2,2-dimethylpropyl)amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CCNCC(C)(C)CO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H32N2O3/c1-7-9-17(13(19)20-14(2,3)4)10-8-16-11-15(5,6)12-18/h16,18H,7-12H2,1-6H3 |
| InChIKey | RYMKAQLGRGJCQV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|