C17H28N2O2 — CID 107248074
tert-butyl N-[2-[(2,4-dimethylphenyl)methylamino]propyl]carbamate (PubChem CID 107248074) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is tert-butyl N-[2-[(2,4-dimethylphenyl)methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2,4-dimethylphenyl)methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 107248074 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | tert-butyl N-[2-[(2,4-dimethylphenyl)methylamino]propyl]carbamate |
| SMILES | Cc1ccc(CNC(C)CNC(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C17H28N2O2/c1-12-7-8-15(13(2)9-12)11-18-14(3)10-19-16(20)21-17(4,5)6/h7-9,14,18H,10-11H2,1-6H3,(H,19,20) |
| InChIKey | USFFRSVAAHBEDC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |