C14H29N3O2 — CID 107248120
tert-butyl N-[2-[(3-aminocyclohexyl)amino]propyl]carbamate (PubChem CID 107248120) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-aminocyclohexyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-aminocyclohexyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 107248120 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | tert-butyl N-[2-[(3-aminocyclohexyl)amino]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)NC1CCCC(N)C1 |
| InChI | InChI=1S/C14H29N3O2/c1-10(9-16-13(18)19-14(2,3)4)17-12-7-5-6-11(15)8-12/h10-12,17H,5-9,15H2,1-4H3,(H,16,18) |
| InChIKey | JUKHANZBRWFFRN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |