C17H26N2O2 — CID 107248356
tert-butyl N-[2-(2,3-dihydro-1H-inden-2-ylamino)propyl]carbamate (PubChem CID 107248356) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is tert-butyl N-[2-(2,3-dihydro-1H-inden-2-ylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,3-dihydro-1H-inden-2-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 107248356 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | tert-butyl N-[2-(2,3-dihydro-1H-inden-2-ylamino)propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H26N2O2/c1-12(11-18-16(20)21-17(2,3)4)19-15-9-13-7-5-6-8-14(13)10-15/h5-8,12,15,19H,9-11H2,1-4H3,(H,18,20) |
| InChIKey | GKFCOKMVTXCHOM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |