C17H31N3O2 — CID 107249905
tert-butyl N-[2-methyl-1-[(1-propylpyrrol-2-yl)methylamino]propan-2-yl]carbamate (PubChem CID 107249905) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[(1-propylpyrrol-2-yl)methylamino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-[(1-propylpyrrol-2-yl)methylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 107249905 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[(1-propylpyrrol-2-yl)methylamino]propan-2-yl]carbamate |
| SMILES | CCCn1cccc1CNCC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31N3O2/c1-7-10-20-11-8-9-14(20)12-18-13-17(5,6)19-15(21)22-16(2,3)4/h8-9,11,18H,7,10,12-13H2,1-6H3,(H,19,21) |
| InChIKey | WUBHIEPUNJJHOZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |